1-(4-BROMOBUTOXY)-4-FLUOROBENZENE structure
|
Common Name | 1-(4-BROMOBUTOXY)-4-FLUOROBENZENE | ||
|---|---|---|---|---|
| CAS Number | 83642-28-8 | Molecular Weight | 327.19400 | |
| Density | 1.5g/cm3 | Boiling Point | 447.8ºC at 760 mmHg | |
| Molecular Formula | C13H11BrO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224.6ºC | |
| Name | 1-(4-bromophenoxy)-4-methylsulfonylbenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5g/cm3 |
|---|---|
| Boiling Point | 447.8ºC at 760 mmHg |
| Molecular Formula | C13H11BrO3S |
| Molecular Weight | 327.19400 |
| Flash Point | 224.6ºC |
| Exact Mass | 325.96100 |
| PSA | 51.75000 |
| LogP | 4.72570 |
| Index of Refraction | 1.597 |
| InChIKey | UTOBNWJHJAXJFP-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)c1ccc(Oc2ccc(Br)cc2)cc1 |
| HS Code | 2909309090 |
|---|
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| GL-1066 |
| Benzene,1-bromo-4-(4-(methylsulfonyl)phenoxy) |