Acetic acid,2-(2,4-dichloro-5-nitrophenoxy)- structure
|
Common Name | Acetic acid,2-(2,4-dichloro-5-nitrophenoxy)- | ||
|---|---|---|---|---|
| CAS Number | 83631-29-2 | Molecular Weight | 266.03500 | |
| Density | 1.659g/cm3 | Boiling Point | 442.3ºC at 760mmHg | |
| Molecular Formula | C8H5Cl2NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221.3ºC | |
| Name | 2-(2,4-dichloro-5-nitrophenoxy)acetic acid |
|---|
| Density | 1.659g/cm3 |
|---|---|
| Boiling Point | 442.3ºC at 760mmHg |
| Molecular Formula | C8H5Cl2NO5 |
| Molecular Weight | 266.03500 |
| Flash Point | 221.3ºC |
| Exact Mass | 264.95400 |
| PSA | 92.35000 |
| LogP | 2.88820 |
| Index of Refraction | 1.608 |
| InChIKey | MNXWREGNAUJMIX-UHFFFAOYSA-N |
| SMILES | O=C(O)COc1cc([N+](=O)[O-])c(Cl)cc1Cl |
| HS Code | 2918990090 |
|---|
|
~%
Acetic acid,2-(... CAS#:83631-29-2 |
| Literature: Cavill; Ford Journal of the Chemical Society, 1954 , p. 565,567 |
|
~%
Acetic acid,2-(... CAS#:83631-29-2 |
| Literature: Wolfe et al. Journal of Organic Chemistry, 1949 , vol. 14, p. 900 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |