7H-3,11b-Epoxy-2H-naphtho(1,2-b)(1,4)dioxepin-7-one, 6-cyclohexyl-3,4-dihydro-
Modify Date: 2025-09-19 20:47:46
7H-3,11b-Epoxy-2H-naphtho(1,2-b)(1,4)dioxepin-7-one, 6-cyclohexyl-3,4-dihydro- structure
|
Common Name | 7H-3,11b-Epoxy-2H-naphtho(1,2-b)(1,4)dioxepin-7-one, 6-cyclohexyl-3,4-dihydro- | ||
|---|---|---|---|---|
| CAS Number | 83570-35-8 | Molecular Weight | 312.36000 | |
| Density | 1.31g/cm3 | Boiling Point | 489ºC at 760 mmHg | |
| Molecular Formula | C19H20O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.5ºC | |
| Name | 5-cyclohexyl-10b,2-epoxymethano-2,3-dihydronaphtho<1,2-b>dioxin-6(10bH)-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 489ºC at 760 mmHg |
| Molecular Formula | C19H20O4 |
| Molecular Weight | 312.36000 |
| Flash Point | 217.5ºC |
| Exact Mass | 312.13600 |
| PSA | 44.76000 |
| LogP | 3.31570 |
| Index of Refraction | 1.621 |
| InChIKey | NYIVNVMZAMRWKZ-UHFFFAOYSA-N |
| SMILES | O=C1C(C2CCCCC2)=C2OCC3COC2(O3)c2ccccc21 |
|
~61%
7H-3,11b-Epoxy-... CAS#:83570-35-8 |
| Literature: Hudson, Alan T.; Pether, Michael J.; Ferrige, Anthony G.; Lindon, John C. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1982 , # 8 p. 1933 - 1936 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 5-cyclohexyl-10b,2-epoxymethano-2,3-dihydronaphtho[1,2-b]dioxin-6(10bH)-one |
| 7H-3,11b-Epoxy-2H-naphtho(1,2-b)(1,4)dioxepin-7-one,6-cyclohexyl-3,4-dihydro |