methyl 2-(1-hydroxy-4-oxo-naphthalen-1-yl)acetate structure
|
Common Name | methyl 2-(1-hydroxy-4-oxo-naphthalen-1-yl)acetate | ||
|---|---|---|---|---|
| CAS Number | 83552-99-2 | Molecular Weight | 232.23200 | |
| Density | 1.297g/cm3 | Boiling Point | 404.3ºC at 760 mmHg | |
| Molecular Formula | C13H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 157ºC | |
| Name | methyl 2-(1-hydroxy-4-oxonaphthalen-1-yl)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.297g/cm3 |
|---|---|
| Boiling Point | 404.3ºC at 760 mmHg |
| Molecular Formula | C13H12O4 |
| Molecular Weight | 232.23200 |
| Flash Point | 157ºC |
| Exact Mass | 232.07400 |
| PSA | 63.60000 |
| LogP | 1.18980 |
| Index of Refraction | 1.585 |
| InChIKey | GLXZFDXJFUVICZ-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1(O)C=CC(=O)c2ccccc21 |
|
~71%
methyl 2-(1-hyd... CAS#:83552-99-2 |
| Literature: Araki, Shuki; Katsumura, Nobuhito; Kawasaki, Ken-ichi; Butsugan, Yasuo Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1991 , # 3 p. 499 - 500 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| METHYL 2-(1-HYDROXY-4-OXO-NAPHTHALEN-1-YL)ACETATE |
| methyl (1,4-dihydro-1-hydroxy-4-oxonaphthalen-1-yl)acetate |