5-methyl-1-p-tolyl-1h-pyrazole-3-carboxylic acid
Modify Date: 2025-11-05 07:07:16
5-methyl-1-p-tolyl-1h-pyrazole-3-carboxylic acid structure
|
Common Name | 5-methyl-1-p-tolyl-1h-pyrazole-3-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 835-60-9 | Molecular Weight | 216.23600 | |
| Density | 1.22g/cm3 | Boiling Point | 392.3ºC at 760 mmHg | |
| Molecular Formula | C12H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191ºC | |
| Name | 5-methyl-1-p-tolyl-1h-pyrazole-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 392.3ºC at 760 mmHg |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.23600 |
| Flash Point | 191ºC |
| Exact Mass | 216.09000 |
| PSA | 55.12000 |
| LogP | 2.18730 |
| Index of Refraction | 1.606 |
| InChIKey | NKHBUGPSFOPHET-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-n2nc(C(=O)O)cc2C)cc1 |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-methyl-1-p-tolyl-1H-pyrazole-3-carboxylic acid ethyl ester |
| 1-n-Propyl-5-methyl-pyrazol |
| 5-Methyl-1-p-tolyl-pyrazol-3-carbonsaeure |
| 5-Methyl-1-p-tolyl-pyrazol-3-carbonsaeure-aethylester |
| 5-Methyl-1-propylpyrazol |
| 1-propyl-5-methylpyrazole |