tetrakis(4-cumylphenoxy)phthalocyanine structure
|
Common Name | tetrakis(4-cumylphenoxy)phthalocyanine | ||
|---|---|---|---|---|
| CAS Number | 83484-76-8 | Molecular Weight | 1355.62000 | |
| Density | 1.263g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C92H74N8O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tetrakis(4-cumylphenoxy)phthalocyanine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.263g/cm3 |
|---|---|
| Molecular Formula | C92H74N8O4 |
| Molecular Weight | 1355.62000 |
| Exact Mass | 1354.58000 |
| PSA | 142.66000 |
| LogP | 18.36560 |
| Index of Refraction | 1.71 |
| InChIKey | WSMFVFRKDITEGM-UHFFFAOYSA-N |
| SMILES | CC(C)(c1ccccc1)c1ccc(Oc2ccc3c(c2)-c2nc-3nc3[nH]c(nc4nc(nc5[nH]c(n2)c2ccc(Oc6ccc(C(C)(C)c7ccccc7)cc6)cc52)-c2ccc(Oc5ccc(C(C)(C)c6ccccc6)cc5)cc2-4)c2ccc(Oc4ccc(C(C)(C)c5ccccc5)cc4)cc32)cc1 |
|
~48%
tetrakis(4-cumy... CAS#:83484-76-8 |
| Literature: Snow, Arthur W.; Jarvis, N. Lynn Journal of the American Chemical Society, 1984 , vol. 106, # 17 p. 4707 - 4711 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| MFCD00192482 |