Hydrazinecarbothioamide,1-methyl-N-phenyl-2-[1-(2-pyridinyl)ethylidene]- structure
|
Common Name | Hydrazinecarbothioamide,1-methyl-N-phenyl-2-[1-(2-pyridinyl)ethylidene]- | ||
|---|---|---|---|---|
| CAS Number | 83476-90-8 | Molecular Weight | 284.37900 | |
| Density | 1.14g/cm3 | Boiling Point | 419.2ºC at 760mmHg | |
| Molecular Formula | C15H16N4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-methyl-3-phenyl-1-[(E)-1-pyridin-2-ylethylideneamino]thiourea |
|---|
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 419.2ºC at 760mmHg |
| Molecular Formula | C15H16N4S |
| Molecular Weight | 284.37900 |
| Exact Mass | 284.11000 |
| PSA | 72.61000 |
| LogP | 3.20740 |
| Index of Refraction | 1.612 |
| InChIKey | YTPOFOXZXJCNCU-LDADJPATSA-N |
| SMILES | CC(=NN(C)C(=S)Nc1ccccc1)c1ccccn1 |
|
~%
Hydrazinecarbot... CAS#:83476-90-8 |
| Literature: Klayman; Scovill; Bartosevich; Bruce Journal of Medicinal Chemistry, 1983 , vol. 26, # 1 p. 35 - 39 |
|
~%
Hydrazinecarbot... CAS#:83476-90-8 |
| Literature: Klayman; Scovill; Bartosevich; Bruce Journal of Medicinal Chemistry, 1983 , vol. 26, # 1 p. 35 - 39 |