1H-Isoindol-1-one,2,3-dihydro-3-hydroxy-2-methyl-3-(1-methylene-2-propen-1-yl)- structure
|
Common Name | 1H-Isoindol-1-one,2,3-dihydro-3-hydroxy-2-methyl-3-(1-methylene-2-propen-1-yl)- | ||
|---|---|---|---|---|
| CAS Number | 83451-46-1 | Molecular Weight | 215.24800 | |
| Density | 1.205g/cm3 | Boiling Point | 406.3ºC at 760mmHg | |
| Molecular Formula | C13H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199.5ºC | |
| Name | 3-buta-1,3-dien-2-yl-3-hydroxy-2-methylisoindol-1-one |
|---|
| Density | 1.205g/cm3 |
|---|---|
| Boiling Point | 406.3ºC at 760mmHg |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.24800 |
| Flash Point | 199.5ºC |
| Exact Mass | 215.09500 |
| PSA | 40.54000 |
| LogP | 1.59740 |
| Index of Refraction | 1.604 |
| InChIKey | UVKFHBYPISACEJ-UHFFFAOYSA-N |
| SMILES | C=CC(=C)C1(O)c2ccccc2C(=O)N1C |
|
~52%
1H-Isoindol-1-o... CAS#:83451-46-1 |
| Literature: Drage, James S.; Earl, Richard A.; Vollhardt, K. Peter C. Journal of Heterocyclic Chemistry, 1982 , vol. 19, p. 701 - 702 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |