4-ethoxycarbonylbicyclo[2.2.2]octane-1-carboxylic acid
Modify Date: 2025-09-13 19:37:20
![4-ethoxycarbonylbicyclo[2.2.2]octane-1-carboxylic acid Structure](https://image.chemsrc.com/caspic/222/834-50-4.png)
4-ethoxycarbonylbicyclo[2.2.2]octane-1-carboxylic acid structure
|
Common Name | 4-ethoxycarbonylbicyclo[2.2.2]octane-1-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 834-50-4 | Molecular Weight | 226.26900 | |
| Density | 1.265g/cm3 | Boiling Point | 336.8ºC at 760 mmHg | |
| Molecular Formula | C12H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-ethoxycarbonylbicyclo[2.2.2]octane-1-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.265g/cm3 |
|---|---|
| Boiling Point | 336.8ºC at 760 mmHg |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.26900 |
| Exact Mass | 226.12100 |
| PSA | 63.60000 |
| LogP | 1.97470 |
| Index of Refraction | 1.543 |
| InChIKey | AKCJDZLLWVXNFU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C12CCC(C(=O)O)(CC1)CC2 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Bicyclo<2.2.2>octan-1,4-dicarbonsaeure-1-ethylester |
| Bicyclo<2.2.2>octan-1,4-dicarbonsaeure-monoethylester |