N-benzyl-2-chloro-2-methyl-3-phenylsulfanylpropanamide structure
|
Common Name | N-benzyl-2-chloro-2-methyl-3-phenylsulfanylpropanamide | ||
|---|---|---|---|---|
| CAS Number | 83375-60-4 | Molecular Weight | 319.84900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H18ClNOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-benzyl-2-chloro-2-methyl-3-phenylsulfanylpropanamide |
|---|
| Molecular Formula | C17H18ClNOS |
|---|---|
| Molecular Weight | 319.84900 |
| Exact Mass | 319.08000 |
| PSA | 57.89000 |
| LogP | 4.93290 |
| InChIKey | MLKRLNPOIVBVFS-UHFFFAOYSA-N |
| SMILES | CC(Cl)(CSc1ccccc1)C(=O)NCc1ccccc1 |
|
~22%
N-benzyl-2-chlo... CAS#:83375-60-4 |
| Literature: Ihara; Haga; Yonekura; et al. Journal of the American Chemical Society, 1983 , vol. 105, # 25 p. 7345 - 7352 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |