3-diazirinophenylretinal structure
|
Common Name | 3-diazirinophenylretinal | ||
|---|---|---|---|---|
| CAS Number | 83374-72-5 | Molecular Weight | 278.34800 | |
| Density | 1.02g/cm3 | Boiling Point | 468.7ºC at 760 mmHg | |
| Molecular Formula | C18H18N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193ºC | |
| Name | (2Z,4Z,6Z,8Z)-9-[3-(3H-diazirin-3-yl)phenyl]-3,7-dimethylnona-2,4,6,8-tetraenal |
|---|---|
| Synonym | More Synonyms |
| Density | 1.02g/cm3 |
|---|---|
| Boiling Point | 468.7ºC at 760 mmHg |
| Molecular Formula | C18H18N2O |
| Molecular Weight | 278.34800 |
| Flash Point | 193ºC |
| Exact Mass | 278.14200 |
| PSA | 41.79000 |
| LogP | 3.68310 |
| Index of Refraction | 1.556 |
| InChIKey | RHFWXGWGGQTUSQ-ZEUUTDFKSA-N |
| SMILES | CC(C=CC=C(C)C=Cc1cccc(C2N=N2)c1)=CC=O |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| meta-Diazirinophenylretinal |
| m-Diazirinophenylretinaldehyde |
| 3-Diazirinophenylretinal |