3-(8-hydroxyquinolin-5-yl)-1-(4-methylphenyl)prop-2-en-1-one structure
|
Common Name | 3-(8-hydroxyquinolin-5-yl)-1-(4-methylphenyl)prop-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 833488-10-1 | Molecular Weight | 289.32800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(8-hydroxyquinolin-5-yl)-1-(4-methylphenyl)prop-2-en-1-one |
|---|
| Molecular Formula | C19H15NO2 |
|---|---|
| Molecular Weight | 289.32800 |
| Exact Mass | 289.11000 |
| PSA | 50.19000 |
| LogP | 4.14490 |
| InChIKey | UZSKNOLLNHKJTB-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)C=Cc2ccc(O)c3ncccc23)cc1 |
|
~28%
3-(8-hydroxyqui... CAS#:833488-10-1 |
| Literature: Marrugo-Gonzalez, Alonso J.; Orlov, Valerie D.; Fernandez-Maestre, Roberto Journal of the Chilean Chemical Society, 2012 , vol. 57, # 3 p. 1287 - 1291 |
|
~%
3-(8-hydroxyqui... CAS#:833488-10-1 |
| Literature: Marrugo-Gonzalez, Alonso J.; Orlov, Valerie D.; Fernandez-Maestre, Roberto Journal of the Chilean Chemical Society, 2012 , vol. 57, # 3 p. 1287 - 1291 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |