6-(3-chloropropyl)-6-(2-methoxyethoxy)-2,5,7,10-tetraoxa-6-silaundecane
Modify Date: 2025-10-27 16:12:52
6-(3-chloropropyl)-6-(2-methoxyethoxy)-2,5,7,10-tetraoxa-6-silaundecane structure
|
Common Name | 6-(3-chloropropyl)-6-(2-methoxyethoxy)-2,5,7,10-tetraoxa-6-silaundecane | ||
|---|---|---|---|---|
| CAS Number | 83315-76-8 | Molecular Weight | 330.87800 | |
| Density | 1.061g/cm3 | Boiling Point | 339.649ºC at 760 mmHg | |
| Molecular Formula | C12H27ClO6Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 132.514ºC | |
| Name | 3-chloropropyl-tris(2-methoxyethoxy)silane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.061g/cm3 |
|---|---|
| Boiling Point | 339.649ºC at 760 mmHg |
| Molecular Formula | C12H27ClO6Si |
| Molecular Weight | 330.87800 |
| Flash Point | 132.514ºC |
| Exact Mass | 330.12700 |
| PSA | 55.38000 |
| LogP | 1.54320 |
| Index of Refraction | 1.437 |
| InChIKey | CIPGKMZNKNYCCP-UHFFFAOYSA-N |
| SMILES | COCCO[Si](CCCCl)(OCCOC)OCCOC |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| einecs 280-375-7 |