5-amino-2-[(4-chlorophenyl)hydrazinylidene]imidazole-4-carboxamide structure
|
Common Name | 5-amino-2-[(4-chlorophenyl)hydrazinylidene]imidazole-4-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 83296-79-1 | Molecular Weight | 264.67100 | |
| Density | 1.7g/cm3 | Boiling Point | 453.9ºC at 760 mmHg | |
| Molecular Formula | C10H9ClN6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 228.3ºC | |
| Name | (2E)-5-amino-2-[(4-chlorophenyl)hydrazinylidene]imidazole-4-carboxamide |
|---|
| Density | 1.7g/cm3 |
|---|---|
| Boiling Point | 453.9ºC at 760 mmHg |
| Molecular Formula | C10H9ClN6O |
| Molecular Weight | 264.67100 |
| Flash Point | 228.3ºC |
| Exact Mass | 264.05300 |
| PSA | 122.51000 |
| LogP | 3.44110 |
| Index of Refraction | 1.775 |
| InChIKey | REKBNQGJBOPNQE-UHFFFAOYSA-N |
| SMILES | NC(=O)c1[nH]c(N=Nc2ccc(Cl)cc2)nc1N |
|
~73%
5-amino-2-[(4-c... CAS#:83296-79-1 |
| Literature: Baig, Ghouse Unissa; Stevens, Malcolm F. G.; Stone, Robert Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1982 , # 8 p. 1811 - 1820 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |