[7-(diacetylamino)-8-methyl-9H-carbazol-3-yl] acetate structure
|
Common Name | [7-(diacetylamino)-8-methyl-9H-carbazol-3-yl] acetate | ||
|---|---|---|---|---|
| CAS Number | 832723-89-4 | Molecular Weight | 338.35700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H18N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [7-(diacetylamino)-8-methyl-9H-carbazol-3-yl] acetate |
|---|
| Molecular Formula | C19H18N2O4 |
|---|---|
| Molecular Weight | 338.35700 |
| Exact Mass | 338.12700 |
| PSA | 79.47000 |
| LogP | 3.45420 |
| InChIKey | OSHORQYUSWQSLI-UHFFFAOYSA-N |
| SMILES | CC(=O)Oc1ccc2[nH]c3c(C)c(N(C(C)=O)C(C)=O)ccc3c2c1 |
|
~%
[7-(diacetylami... CAS#:832723-89-4 |
| Literature: Guillonneau, Claude; Nault, Annette; Raimbaud, Eric; Leonce, Stephane; Kraus-Berthier, Laurence; Pierre, Alain; Goldstein, Solo Bioorganic and Medicinal Chemistry, 2005 , vol. 13, # 1 p. 175 - 184 |
|
~63%
[7-(diacetylami... CAS#:832723-89-4 |
| Literature: Guillonneau, Claude; Nault, Annette; Raimbaud, Eric; Leonce, Stephane; Kraus-Berthier, Laurence; Pierre, Alain; Goldstein, Solo Bioorganic and Medicinal Chemistry, 2005 , vol. 13, # 1 p. 175 - 184 |
| Precursor 3 | |
|---|---|
| DownStream 6 | |