ethyl N-[2-amino-9-[4-(trifluoromethyl)phenyl]-3,7,10-triazabicyclo[4.4.0]deca-1,3,5,7,9-pentaen-4-yl]carbamate
Modify Date: 2025-08-24 18:02:36
![ethyl N-[2-amino-9-[4-(trifluoromethyl)phenyl]-3,7,10-triazabicyclo[4.4.0]deca-1,3,5,7,9-pentaen-4-yl]carbamate Structure](https://image.chemsrc.com/caspic/414/83269-16-3.png)
ethyl N-[2-amino-9-[4-(trifluoromethyl)phenyl]-3,7,10-triazabicyclo[4.4.0]deca-1,3,5,7,9-pentaen-4-yl]carbamate structure
|
Common Name | ethyl N-[2-amino-9-[4-(trifluoromethyl)phenyl]-3,7,10-triazabicyclo[4.4.0]deca-1,3,5,7,9-pentaen-4-yl]carbamate | ||
|---|---|---|---|---|
| CAS Number | 83269-16-3 | Molecular Weight | 377.32100 | |
| Density | 1.449g/cm3 | Boiling Point | 490.7ºC at 760 mmHg | |
| Molecular Formula | C17H14F3N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 250.5ºC | |
| Name | ethyl N-[5-amino-3-[4-(trifluoromethyl)phenyl]pyrido[3,4-b]pyrazin-7-yl]carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.449g/cm3 |
|---|---|
| Boiling Point | 490.7ºC at 760 mmHg |
| Molecular Formula | C17H14F3N5O2 |
| Molecular Weight | 377.32100 |
| Flash Point | 250.5ºC |
| Exact Mass | 377.11000 |
| PSA | 103.02000 |
| LogP | 4.51540 |
| Index of Refraction | 1.631 |
| InChIKey | HBGYYYWNIJUNIU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Nc1cc2ncc(-c3ccc(C(F)(F)F)cc3)nc2c(N)n1 |
|
~19%
ethyl N-[2-amin... CAS#:83269-16-3 |
| Literature: Temple Jr.; Wheeler; Elliott; Rose; Comber; Montgomery Journal of Medicinal Chemistry, 1983 , vol. 26, # 1 p. 91 - 95 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| ethyl 5-amino-3-[4-(trifluoromethyl)phenyl]pyrido[3,4-b]pyrazine-7-carbamate |
| ETHYL N-[2-AMINO-9-[4-(TRIFLUOROMETHYL)PHENYL]-3,7,10-TRIAZABICYCLO[4.4.0]DECA-1,3,5,7,9-PENTAEN-4-YL]CARBAMATE |