2-(4,6-diphenyl-1,3,5-triazin-2-yl)-N,N-dimethylethenamine
Modify Date: 2025-08-28 00:01:13
2-(4,6-diphenyl-1,3,5-triazin-2-yl)-N,N-dimethylethenamine structure
|
Common Name | 2-(4,6-diphenyl-1,3,5-triazin-2-yl)-N,N-dimethylethenamine | ||
|---|---|---|---|---|
| CAS Number | 83256-22-8 | Molecular Weight | 302.37300 | |
| Density | 1.143g/cm3 | Boiling Point | 505.5ºC at 760 mmHg | |
| Molecular Formula | C19H18N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 259.5ºC | |
| Name | 2-(4,6-diphenyl-1,3,5-triazin-2-yl)-N,N-dimethylethenamine |
|---|
| Density | 1.143g/cm3 |
|---|---|
| Boiling Point | 505.5ºC at 760 mmHg |
| Molecular Formula | C19H18N4 |
| Molecular Weight | 302.37300 |
| Flash Point | 259.5ºC |
| Exact Mass | 302.15300 |
| PSA | 41.91000 |
| LogP | 3.73790 |
| Index of Refraction | 1.628 |
| InChIKey | WANDDFKYYZYGCI-BUHFOSPRSA-N |
| SMILES | CN(C)C=Cc1nc(-c2ccccc2)nc(-c2ccccc2)n1 |
|
~32%
2-(4,6-diphenyl... CAS#:83256-22-8 |
| Literature: Prikazchikova, L. P.; Khutova, B. M.; Cherkasov, V. M. Chemistry of Heterocyclic Compounds (New York, NY, United States), 1982 , vol. 18, # 7 p. 746 - 748 Khimiya Geterotsiklicheskikh Soedinenii, 1982 , # 7 p. 974 - 976 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |