1-nitro-4-[2-[2-[2-[2-[2-[2-[2-[2-(4-nitrophenoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]benzene
Modify Date: 2025-09-28 16:16:47
![1-nitro-4-[2-[2-[2-[2-[2-[2-[2-[2-(4-nitrophenoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]benzene Structure](https://image.chemsrc.com/caspic/482/82959-74-8.png)
1-nitro-4-[2-[2-[2-[2-[2-[2-[2-[2-(4-nitrophenoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]benzene structure
|
Common Name | 1-nitro-4-[2-[2-[2-[2-[2-[2-[2-[2-(4-nitrophenoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]benzene | ||
|---|---|---|---|---|
| CAS Number | 82959-74-8 | Molecular Weight | 612.62300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H40N2O13 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-nitro-4-[2-[2-[2-[2-[2-[2-[2-[2-(4-nitrophenoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]benzene |
|---|
| Molecular Formula | C28H40N2O13 |
|---|---|
| Molecular Weight | 612.62300 |
| Exact Mass | 612.25300 |
| PSA | 174.71000 |
| LogP | 4.12340 |
| InChIKey | YXKMRZDYSVMPAT-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(OCCOCCOCCOCCOCCOCCOCCOCCOc2ccc([N+](=O)[O-])cc2)cc1 |
|
~82%
1-nitro-4-[2-[2... CAS#:82959-74-8 |
| Literature: Shinkai, Seiji; Minami, Takahide; Kusano, Yumiko; Manabe, Osamu Journal of the American Chemical Society, 1983 , vol. 105, # 7 p. 1851 - 1856 |
![1-[2-[2-(2-chloroethoxy)ethoxy]ethoxy]-2-[2-[2-[2-(2-chloroethoxy)ethoxy]ethoxy]ethoxy]ethane structure](https://image.chemsrc.com/caspic/496/54797-77-2.png)
| Precursor 2 | |
|---|---|
| DownStream 0 | |