4-Cumylphenhyl chloroformate structure
|
Common Name | 4-Cumylphenhyl chloroformate | ||
|---|---|---|---|---|
| CAS Number | 82941-10-4 | Molecular Weight | 274.74200 | |
| Density | 1.168 g/cm3 | Boiling Point | 350.73ºC at 760 mmHg | |
| Molecular Formula | C16H15ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 155.693ºC | |
| Name | 4-Cumylphenhyl chloroformate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.168 g/cm3 |
|---|---|
| Boiling Point | 350.73ºC at 760 mmHg |
| Molecular Formula | C16H15ClO2 |
| Molecular Weight | 274.74200 |
| Flash Point | 155.693ºC |
| Exact Mass | 274.07600 |
| PSA | 26.30000 |
| LogP | 4.75010 |
| InChIKey | XSIZHTUSUPHZFF-UHFFFAOYSA-N |
| SMILES | CC(C)(c1ccccc1)c1ccc(OC(=O)Cl)cc1 |
| HS Code | 2915900090 |
|---|
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| Carbonochloridic acid 4-(1-methyl-1-phenylethyl)phenyl ester |
| 4-Cumylphenyl chloroformate |