S-Etomxir structure
|
Common Name | S-Etomxir | ||
|---|---|---|---|---|
| CAS Number | 828934-43-6 | Molecular Weight | 320.74400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H18ClNaO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of S-EtomxirS isomer of R-Etomoxir |
| Name | Sodium (2S)-2-[6-(4-chlorophenoxy)hexyl]-2-oxiranecarboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H18ClNaO4 |
|---|---|
| Molecular Weight | 320.74400 |
| Exact Mass | 320.07900 |
| PSA | 61.89000 |
| LogP | 2.18820 |
| InChIKey | RPACBEVZENYWOL-RSAXXLAASA-M |
| SMILES | O=C([O-])C1(CCCCCCOc2ccc(Cl)cc2)CO1.[Na+] |
| (2S)-2-[6-(4-Chlorophenoxy)hexyl]oxiranecarboxylic acid sodium salt |
| S-Etomxir |