2-(1-chlorobut-3-en-2-yl)-2-methylcyclopentane-1,3-dione
2-(1-chlorobut-3-en-2-yl)-2-methylcyclopentane-1,3-dione structure
|
Common Name | 2-(1-chlorobut-3-en-2-yl)-2-methylcyclopentane-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 82891-02-9 | Molecular Weight | 200.66200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H13ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(1-chlorobut-3-en-2-yl)-2-methylcyclopentane-1,3-dione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H13ClO2 |
|---|---|
| Molecular Weight | 200.66200 |
| Exact Mass | 200.06000 |
| PSA | 34.14000 |
| LogP | 1.96570 |
| InChIKey | NONFGDKGTHCRNR-UHFFFAOYSA-N |
| SMILES | C=CC(CCl)C1(C)C(=O)CCC1=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2-(1-chlorobut-... CAS#:82891-02-9 |
| Literature: Trost; McDougal; Haller Journal of the American Chemical Society, 1984 , vol. 106, # 2 p. 383 - 395 |
|
~%
2-(1-chlorobut-... CAS#:82891-02-9 |
| Literature: Trost; McDougal; Haller Journal of the American Chemical Society, 1984 , vol. 106, # 2 p. 383 - 395 |
|
~%
2-(1-chlorobut-... CAS#:82891-02-9 |
| Literature: Trost; McDougal Journal of the American Chemical Society, 1982 , vol. 104, # 22 p. 6110 - 6112 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 2-(1-chlorobut-3-en-2-yl)-2-methylcyclopentane-1,3-dione? |
| A: The English name of 2-(1-chlorobut-3-en-2-yl)-2-methylcyclopentane-1,3-dione is 2-(1-chlorobut-3-en-2-yl)-2-methylcyclopentane-1,3-dione. |
| Q: What is the Chinese name of 82891-02-9? |
| A: Chinese name of 82891-02-9 is 82891-02-9. |
| Q: What is the SMILES notation of 2-(1-chlorobut-3-en-2-yl)-2-methylcyclopentane-1,3-dione? |
| A: SMILES notation of 2-(1-chlorobut-3-en-2-yl)-2-methylcyclopentane-1,3-dione is C=CC(CCl)C1(C)C(=O)CCC1=O. |
| Q: What is the molecular formula of 2-(1-chlorobut-3-en-2-yl)-2-methylcyclopentane-1,3-dione? |
| A: Molecular formula of 2-(1-chlorobut-3-en-2-yl)-2-methylcyclopentane-1,3-dione is C10H13ClO2. |
| Q: What is the CAS number of 2-(1-chlorobut-3-en-2-yl)-2-methylcyclopentane-1,3-dione? |
| A: CAS number of 2-(1-chlorobut-3-en-2-yl)-2-methylcyclopentane-1,3-dione is 82891-02-9. |
| Q: What is the LogP of 2-(1-chlorobut-3-en-2-yl)-2-methylcyclopentane-1,3-dione? |
| A: LogP of 2-(1-chlorobut-3-en-2-yl)-2-methylcyclopentane-1,3-dione is 1.96570. |
| Q: What are the upstream materials of 2-(1-chlorobut-3-en-2-yl)-2-methylcyclopentane-1,3-dione? |
| A: Related upstream materials(CAS) of 2-(1-chlorobut-3-en-2-yl)-2-methylcyclopentane-1,3-dione: 765-69-5;87902-36-1;1576-93-8. |
| Q: What is the molecular weight of 2-(1-chlorobut-3-en-2-yl)-2-methylcyclopentane-1,3-dione? |
| A: Molecular weight of 2-(1-chlorobut-3-en-2-yl)-2-methylcyclopentane-1,3-dione is 200.66200. |
| Q: What is the InChIKey of 2-(1-chlorobut-3-en-2-yl)-2-methylcyclopentane-1,3-dione? |
| A: InChIKey of 2-(1-chlorobut-3-en-2-yl)-2-methylcyclopentane-1,3-dione is NONFGDKGTHCRNR-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 2-(1-chlorobut-3-en-2-yl)-2-methylcyclopentane-1,3-dione? |
| A: Polar surface area (PSA) of 2-(1-chlorobut-3-en-2-yl)-2-methylcyclopentane-1,3-dione is 34.14000. |