2-(3-methoxyphenoxy)-5-nitrobenzonitrile
Modify Date: 2025-09-18 20:15:10
2-(3-methoxyphenoxy)-5-nitrobenzonitrile structure
|
Common Name | 2-(3-methoxyphenoxy)-5-nitrobenzonitrile | ||
|---|---|---|---|---|
| CAS Number | 82673-96-9 | Molecular Weight | 270.24000 | |
| Density | 1.35g/cm3 | Boiling Point | 392.9ºC at 760 mmHg | |
| Molecular Formula | C14H10N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.4ºC | |
| Name | 2-(3-methoxyphenoxy)-5-nitrobenzonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 392.9ºC at 760 mmHg |
| Molecular Formula | C14H10N2O4 |
| Molecular Weight | 270.24000 |
| Flash Point | 191.4ºC |
| Exact Mass | 270.06400 |
| PSA | 88.07000 |
| LogP | 3.79058 |
| Index of Refraction | 1.618 |
| InChIKey | AGCPOYBCAIEKMA-UHFFFAOYSA-N |
| SMILES | COc1cccc(Oc2ccc([N+](=O)[O-])cc2C#N)c1 |
|
~%
2-(3-methoxyphe... CAS#:82673-96-9 |
| Literature: Puerstinger, Gerhard; De Palma, Armando M.; Zimmerhofer, Guenther; Huber, Simone; Ladurner, Sophie; Neyts, Johan Bioorganic and Medicinal Chemistry Letters, 2008 , vol. 18, # 18 p. 5123 - 5125 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Benzonitrile,2-(3-methoxyphenoxy)-5-nitro |
| 2-(3-METHOXYPHENOXY)-5-NITRO-BENZONITRILE |