5,5-Dimethyl-3-(pentylamino)cyclohex-2-enone structure
|
Common Name | 5,5-Dimethyl-3-(pentylamino)cyclohex-2-enone | ||
|---|---|---|---|---|
| CAS Number | 82663-50-1 | Molecular Weight | 209.32800 | |
| Density | 0.93g/cm3 | Boiling Point | 306.3ºC at 760 mmHg | |
| Molecular Formula | C13H23NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 104.5ºC | |
| Name | 5,5-dimethyl-3-(pentylamino)cyclohex-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 0.93g/cm3 |
|---|---|
| Boiling Point | 306.3ºC at 760 mmHg |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.32800 |
| Flash Point | 104.5ºC |
| Exact Mass | 209.17800 |
| PSA | 29.10000 |
| LogP | 3.43010 |
| Index of Refraction | 1.482 |
| InChIKey | FFEMJBAQTJMHCO-UHFFFAOYSA-N |
| SMILES | CCCCCNC1=CC(=O)CC(C)(C)C1 |
| HS Code | 2922399090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 5,5-Dimethyl-3-(pentylamino)cyclohex-2-enone |
| 5,5-Dimethyl-3-(n-pentylamino)cyclohex-2-en-1-one |