methyl 1-(4,5-dimethoxy-2-nitro-benzoyl)pyrrole-2-carboxylate structure
|
Common Name | methyl 1-(4,5-dimethoxy-2-nitro-benzoyl)pyrrole-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 82635-52-7 | Molecular Weight | 334.28100 | |
| Density | 1.36g/cm3 | Boiling Point | 477.7ºC at 760 mmHg | |
| Molecular Formula | C15H14N2O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 242.7ºC | |
| Name | methyl 1-(4,5-dimethoxy-2-nitrobenzoyl)pyrrole-2-carboxylate |
|---|
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 477.7ºC at 760 mmHg |
| Molecular Formula | C15H14N2O7 |
| Molecular Weight | 334.28100 |
| Flash Point | 242.7ºC |
| Exact Mass | 334.08000 |
| PSA | 112.58000 |
| LogP | 2.41180 |
| Index of Refraction | 1.58 |
| InChIKey | ZUJVYOLKIXJLIL-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cccn1C(=O)c1cc(OC)c(OC)cc1[N+](=O)[O-] |
|
~%
methyl 1-(4,5-d... CAS#:82635-52-7 |
| Literature: Singh, Rajeshwar; Jain, Padam C.; Anand, Nitya Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1982 , vol. 21, # 3 p. 225 - 227 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |