[6-(4-methylphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]methanol
Modify Date: 2025-09-18 12:47:22
![[6-(4-methylphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]methanol Structure](https://image.chemsrc.com/caspic/188/82588-60-1.png)
[6-(4-methylphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]methanol structure
|
Common Name | [6-(4-methylphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]methanol | ||
|---|---|---|---|---|
| CAS Number | 82588-60-1 | Molecular Weight | 244.31200 | |
| Density | 1.33g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H12N2OS | Melting Point | 192-194ºC | |
| MSDS | USA | Flash Point | N/A | |
| Name | [6-(4-methylphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]methanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.33g/cm3 |
|---|---|
| Melting Point | 192-194ºC |
| Molecular Formula | C13H12N2OS |
| Molecular Weight | 244.31200 |
| Exact Mass | 244.06700 |
| PSA | 65.77000 |
| LogP | 2.86350 |
| Index of Refraction | 1.695 |
| InChIKey | WYWLCPJDSLGCMM-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-c2nc3sccn3c2CO)cc1 |
| HS Code | 2934100090 |
|---|
|
~%
[6-(4-methylphe... CAS#:82588-60-1 |
| Literature: Archiv der Pharmazie, , vol. 315, # 5 p. 451 - 456 |
|
~%
[6-(4-methylphe... CAS#:82588-60-1 |
| Literature: Archiv der Pharmazie, , vol. 315, # 5 p. 451 - 456 |
![7-(4-methylphenyl)-4-thia-1,6-diazabicyclo[3.3.0]octa-2,5,7-triene-8-carbaldehyde structure](https://image.chemsrc.com/caspic/036/82588-42-9.png)
![Imidazo[2,1-b]thiazole,6-(4-methylphenyl)- structure](https://image.chemsrc.com/caspic/263/7008-64-2.png)
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| methylphenylimidazobthiazolylmethanol |
| 5-Hydroxymethyl-6-p-tolylimidazo<2,1-b>thiazole |