CHEMBRDG-BB 7941081 structure
|
Common Name | CHEMBRDG-BB 7941081 | ||
|---|---|---|---|---|
| CAS Number | 825657-70-3 | Molecular Weight | 244.33200 | |
| Density | 1.098g/cm3 | Boiling Point | 450.9ºC at 760 mmHg | |
| Molecular Formula | C15H20N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226.5ºC | |
| Name | 2-amino-N-[2-(cyclohexen-1-yl)ethyl]benzamide |
|---|
| Density | 1.098g/cm3 |
|---|---|
| Boiling Point | 450.9ºC at 760 mmHg |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.33200 |
| Flash Point | 226.5ºC |
| Exact Mass | 244.15800 |
| PSA | 55.12000 |
| LogP | 3.86120 |
| Index of Refraction | 1.58 |
| InChIKey | VUVCDDVYWNXVJC-UHFFFAOYSA-N |
| SMILES | Nc1ccccc1C(=O)NCCC1=CCCCC1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |