3-tert-Butyl-4H-indeno(2,1-d)isoxazol-4-one
Modify Date: 2025-09-26 23:29:35
3-tert-Butyl-4H-indeno(2,1-d)isoxazol-4-one structure
|
Common Name | 3-tert-Butyl-4H-indeno(2,1-d)isoxazol-4-one | ||
|---|---|---|---|---|
| CAS Number | 82501-33-5 | Molecular Weight | 227.25900 | |
| Density | 1.211g/cm3 | Boiling Point | 392.9ºC at 760 mmHg | |
| Molecular Formula | C14H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.4ºC | |
| Name | 3-tert-butylindeno[2,1-d][1,2]oxazol-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.211g/cm3 |
|---|---|
| Boiling Point | 392.9ºC at 760 mmHg |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.25900 |
| Flash Point | 191.4ºC |
| Exact Mass | 227.09500 |
| PSA | 43.10000 |
| LogP | 3.18350 |
| Index of Refraction | 1.583 |
| InChIKey | BMDHNHWPNFUMLL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1noc2c1C(=O)c1ccccc1-2 |
|
~66%
3-tert-Butyl-4H... CAS#:82501-33-5 |
| Literature: Lemke, Thomas L.; Sawhney, Kailash N.; Lemke, B. Kaye Journal of Heterocyclic Chemistry, 1982 , vol. 19, p. 363 - 368 |
|
~%
3-tert-Butyl-4H... CAS#:82501-33-5 |
| Literature: Lemke, Thomas L.; Sawhney, Kailash N.; Lemke, B. Kaye Journal of Heterocyclic Chemistry, 1982 , vol. 19, p. 363 - 368 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-t-Butylideno<1,2-c>isoxazol-4-one |
| 3-tert-Butyl-4H-indeno(2,1-d)isoxazol-4-one |
| 3-t-Butylindeno[1,2-c]isoxazol-4-one |