5-(methoxymethyl)-2-nitrophenol
Modify Date: 2025-11-25 22:43:11
5-(methoxymethyl)-2-nitrophenol structure
|
Common Name | 5-(methoxymethyl)-2-nitrophenol | ||
|---|---|---|---|---|
| CAS Number | 824933-92-8 | Molecular Weight | 183.16100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H9NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(methoxymethyl)-2-nitrophenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H9NO4 |
|---|---|
| Molecular Weight | 183.16100 |
| Exact Mass | 183.05300 |
| PSA | 75.28000 |
| LogP | 1.97000 |
| InChIKey | GXCQSXIZLXSDNE-UHFFFAOYSA-N |
| SMILES | COCc1ccc([N+](=O)[O-])c(O)c1 |
|
~%
5-(methoxymethy... CAS#:824933-92-8 |
| Literature: The Procter and Gamble Company Patent: US2005/5370 A1, 2005 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5-Methoxymethyl 2-Nitro phenol |
| Phenol,5-(methoxymethyl)-2-nitro |