3,6-bis[(4-chlorophenyl)methyl]-1,4-dihydro-1,2,4,5-tetrazine
Modify Date: 2025-08-27 09:32:02
![3,6-bis[(4-chlorophenyl)methyl]-1,4-dihydro-1,2,4,5-tetrazine Structure](https://image.chemsrc.com/caspic/179/82481-31-0.png)
3,6-bis[(4-chlorophenyl)methyl]-1,4-dihydro-1,2,4,5-tetrazine structure
|
Common Name | 3,6-bis[(4-chlorophenyl)methyl]-1,4-dihydro-1,2,4,5-tetrazine | ||
|---|---|---|---|---|
| CAS Number | 82481-31-0 | Molecular Weight | 333.21500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H14Cl2N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,6-bis[(4-chlorophenyl)methyl]-1,4-dihydro-1,2,4,5-tetrazine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H14Cl2N4 |
|---|---|
| Molecular Weight | 333.21500 |
| Exact Mass | 332.06000 |
| PSA | 57.36000 |
| LogP | 4.18340 |
| InChIKey | LYWYRVJEQHGTQG-UHFFFAOYSA-N |
| SMILES | Clc1ccc(CC2=NNC(Cc3ccc(Cl)cc3)=NN2)cc1 |
|
~31%
3,6-bis[(4-chlo... CAS#:82481-31-0 |
| Literature: Rao, Guo-Wu; Hu, Wei-Xiao Bioorganic and Medicinal Chemistry Letters, 2006 , vol. 16, # 14 p. 3702 - 3705 |
|
~%
3,6-bis[(4-chlo... CAS#:82481-31-0 |
| Literature: Hunter, Daniel; Neilson, Douglas G.; Weakley, Timothy J.R. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1982 , p. 1165 - 1170 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3,6-bis(4-chlorobenzyl)-1,4-dihydro-1,2,4,5-tetrazine |
| 3,6-bis(4-chlorobenzyl)-1,4-dihydro-s-tetrazine |