7-(diethylamino)-4-(trifluoromethyl)-1,3-benzoxazin-2-one
Modify Date: 2025-08-25 18:44:14
7-(diethylamino)-4-(trifluoromethyl)-1,3-benzoxazin-2-one structure
|
Common Name | 7-(diethylamino)-4-(trifluoromethyl)-1,3-benzoxazin-2-one | ||
|---|---|---|---|---|
| CAS Number | 823190-63-2 | Molecular Weight | 286.25000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H13F3N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 7-(diethylamino)-4-(trifluoromethyl)-1,3-benzoxazin-2-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H13F3N2O2 |
|---|---|
| Molecular Weight | 286.25000 |
| Exact Mass | 286.09300 |
| PSA | 46.34000 |
| LogP | 3.05300 |
| InChIKey | MCMREKAHXXMJIW-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1ccc2c(C(F)(F)F)nc(=O)oc2c1 |
|
~%
7-(diethylamino... CAS#:823190-63-2 |
| Literature: Vovk; Bol'but; Lebed'; Boiko Chemistry of Heterocyclic Compounds, 2004 , vol. 40, # 1 p. 101 - 105 |
|
~%
7-(diethylamino... CAS#:823190-63-2 |
| Literature: Vovk; Bol'but; Lebed'; Boiko Chemistry of Heterocyclic Compounds, 2004 , vol. 40, # 1 p. 101 - 105 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2H-1,3-Benzoxazin-2-one,7-(diethylamino)-4-(trifluoromethyl) |