benzyl N-(4-bromo-3-oxobutyl)carbamate structure
|
Common Name | benzyl N-(4-bromo-3-oxobutyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 82267-34-3 | Molecular Weight | 300.14800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | benzyl N-(4-bromo-3-oxobutyl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H14BrNO3 |
|---|---|
| Molecular Weight | 300.14800 |
| Exact Mass | 299.01600 |
| PSA | 58.89000 |
| LogP | 2.47130 |
| InChIKey | ZODIUSPBGUKUAQ-UHFFFAOYSA-N |
| SMILES | O=C(CBr)CCNC(=O)OCc1ccccc1 |
|
~73%
benzyl N-(4-bro... CAS#:82267-34-3 |
| Literature: Shiba, Tetsuo; Akiyama, Hitoshi; Umeda, Isao; Okada, Satoshi Bulletin of the Chemical Society of Japan, 1982 , vol. 55, # 3 p. 899 - 903 |
|
~%
benzyl N-(4-bro... CAS#:82267-34-3 |
| Literature: Shiba, Tetsuo; Akiyama, Hitoshi; Umeda, Isao; Okada, Satoshi Bulletin of the Chemical Society of Japan, 1982 , vol. 55, # 3 p. 899 - 903 |
|
~%
benzyl N-(4-bro... CAS#:82267-34-3 |
| Literature: Shiba, Tetsuo; Akiyama, Hitoshi; Umeda, Isao; Okada, Satoshi Bulletin of the Chemical Society of Japan, 1982 , vol. 55, # 3 p. 899 - 903 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-bromo-4-benzyloxycarbonylamino-2-butanone |
| (4-BROMO-3-OXO-BUTYL)-CARBAMIC ACID BENZYL ESTER |
| BENZYL 4-BROMO-3-OXOBUTYLCARBAMATE |
| 4-benzyloxycarbonylamino-1-bromo-2-butanone |