N-ethyl-2,4,6,8-tetrakis(4-methoxyphenyl)-9-oxo-3,7-diazabicyclo[3.3.1]nonane-3-carboxamide structure
|
Common Name | N-ethyl-2,4,6,8-tetrakis(4-methoxyphenyl)-9-oxo-3,7-diazabicyclo[3.3.1]nonane-3-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 82058-39-7 | Molecular Weight | 635.74900 | |
| Density | 1.191g/cm3 | Boiling Point | 799.4ºC at 760 mmHg | |
| Molecular Formula | C38H41N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 437.3ºC | |
| Name | N-ethyl-2,4,6,8-tetrakis(4-methoxyphenyl)-9-oxo-3,7-diazabicyclo[3.3.1]nonane-3-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.191g/cm3 |
|---|---|
| Boiling Point | 799.4ºC at 760 mmHg |
| Molecular Formula | C38H41N3O6 |
| Molecular Weight | 635.74900 |
| Flash Point | 437.3ºC |
| Exact Mass | 635.30000 |
| PSA | 101.85000 |
| LogP | 6.90690 |
| Index of Refraction | 1.586 |
| InChIKey | XHYLCUXDQNYRPI-UHFFFAOYSA-N |
| SMILES | CCNC(=O)N1C(c2ccc(OC)cc2)C2C(=O)C(C(c3ccc(OC)cc3)NC2c2ccc(OC)cc2)C1c1ccc(OC)cc1 |
|
~62%
N-ethyl-2,4,6,8... CAS#:82058-39-7 |
| Literature: Ribalta; Ribas; Martinez Tobed; et al. European Journal of Medicinal Chemistry, 1982 , vol. 17, # 2 p. 187 - 190 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| ITA 471 |
| 3,7-Diazabicyclo(3.3.1)nonane-3-carboxamide,N-ethyl-9-oxo-2,4,6,8-tetrakis(p-methoxyphenyl) |