trimethyl-(2-methyl-6-phenylhex-2-en-5-yn-3-yl)stannane structure
|
Common Name | trimethyl-(2-methyl-6-phenylhex-2-en-5-yn-3-yl)stannane | ||
|---|---|---|---|---|
| CAS Number | 820250-83-7 | Molecular Weight | 333.04700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H22Sn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trimethyl-(2-methyl-6-phenylhex-2-en-5-yn-3-yl)stannane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H22Sn |
|---|---|
| Molecular Weight | 333.04700 |
| Exact Mass | 334.07400 |
| LogP | 4.16770 |
| InChIKey | QAPMTCLXZGZCGT-UHFFFAOYSA-N |
| SMILES | CC(C)=C(CC#Cc1ccccc1)[Sn](C)(C)C |
|
~%
trimethyl-(2-me... CAS#:820250-83-7 |
| Literature: Shirakawa, Eiji; Hiyama, Tamejiro Bulletin of the Chemical Society of Japan, 2002 , vol. 75, # 7 p. 1435 - 1450 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Stannane,trimethyl[1-(1-methylethylidene)-4-phenyl-3-butynyl] |
| 5-methyl-1-phenyl-4-trimethylstannyl-4-hexen-1-yne |