(4-chloro-3-nitrophenyl) phenyl sulfate structure
|
Common Name | (4-chloro-3-nitrophenyl) phenyl sulfate | ||
|---|---|---|---|---|
| CAS Number | 820220-74-4 | Molecular Weight | 329.71300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H8ClNO6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-chloro-3-nitrophenyl) phenyl sulfate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H8ClNO6S |
|---|---|
| Molecular Weight | 329.71300 |
| Exact Mass | 328.97600 |
| PSA | 106.80000 |
| LogP | 4.55480 |
| InChIKey | CTRLAFNYVSKITJ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(OS(=O)(=O)Oc2ccccc2)ccc1Cl |
|
~22%
(4-chloro-3-nit... CAS#:820220-74-4 |
| Literature: Younker, Jarod M.; Hengge, Alvan C. Journal of Organic Chemistry, 2004 , vol. 69, # 26 p. 9043 - 9048 |
|
~%
(4-chloro-3-nit... CAS#:820220-74-4 |
| Literature: Younker, Jarod M.; Hengge, Alvan C. Journal of Organic Chemistry, 2004 , vol. 69, # 26 p. 9043 - 9048 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Sulfuric acid,4-chloro-3-nitrophenyl phenyl ester |
| 4-chloro-3-nitrophenyl phenyl sulfate |