carbonic acid, compound with 1-(2-methoxyphenyl)piperazine (1:2) structure
|
Common Name | carbonic acid, compound with 1-(2-methoxyphenyl)piperazine (1:2) | ||
|---|---|---|---|---|
| CAS Number | 82010-88-6 | Molecular Weight | 446.54000 | |
| Density | N/A | Boiling Point | 696.5ºC at 760 mmHg | |
| Molecular Formula | C23H34N4O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 375ºC | |
| Name | carbonic acid,1-(2-methoxyphenyl)piperazine |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 696.5ºC at 760 mmHg |
|---|---|
| Molecular Formula | C23H34N4O5 |
| Molecular Weight | 446.54000 |
| Flash Point | 375ºC |
| Exact Mass | 446.25300 |
| PSA | 106.53000 |
| LogP | 3.21960 |
| InChIKey | INQXKLUQTNOTIG-UHFFFAOYSA-N |
| SMILES | COc1ccccc1N1CCNCC1.COc1ccccc1N1CCNCC1.O=C(O)O |
| EINECS 279-883-1 |
| Carbonic acid,compound with 1-(2-methoxyphenyl)piperazine (1:2) |