diethyl sulphate, compound with N-methyl-N-[4-[(1-methyl-1H-1,2,4-triazol-3-yl)azo]phenyl]benzylamine (1:1) structure
|
Common Name | diethyl sulphate, compound with N-methyl-N-[4-[(1-methyl-1H-1,2,4-triazol-3-yl)azo]phenyl]benzylamine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 81921-73-5 | Molecular Weight | 432.49700 | |
| Density | N/A | Boiling Point | 650.2ºC at 760 mmHg | |
| Molecular Formula | C19H24N6O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 347.1ºC | |
| Name | N-benzyl-N-methyl-4-[(1-methyl-1,2,4-triazol-3-yl)diazenyl]aniline,dimethyl sulfate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 650.2ºC at 760 mmHg |
|---|---|
| Molecular Formula | C19H24N6O4S |
| Molecular Weight | 432.49700 |
| Flash Point | 347.1ºC |
| Exact Mass | 432.15800 |
| PSA | 119.65000 |
| LogP | 4.47170 |
| InChIKey | MKDRILGDKZWIRV-UHFFFAOYSA-N |
| SMILES | CN(Cc1ccccc1)c1ccc(N=Nc2ncn(C)n2)cc1.COS(=O)(=O)OC |
| EINECS 279-850-1 |
| Sulfuric acid,dimethyl ester,compd. with N-methyl-N-(4-((1-methyl-1H-1,2,4-triazol-3-yl)azo)phenyl)benzenemethanamine (1:1) |
| Diethyl sulphate,compound with N-methyl-N-(4-((1-methyl-1H-1,2,4-triazol-3-yl)azo)phenyl)benzylamine (1:1) |