Propan-2-yl 2-chloro-5-(1,3-dioxo-1,3,4,5,6,7-hexahydro-2h-isoindol-2-yl)-4-fluorobenzoate
Modify Date: 2026-06-26 23:12:50
Propan-2-yl 2-chloro-5-(1,3-dioxo-1,3,4,5,6,7-hexahydro-2h-isoindol-2-yl)-4-fluorobenzoate structure
|
Common Name | Propan-2-yl 2-chloro-5-(1,3-dioxo-1,3,4,5,6,7-hexahydro-2h-isoindol-2-yl)-4-fluorobenzoate | ||
|---|---|---|---|---|
| CAS Number | 81663-36-7 | Molecular Weight | 365.8 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H17ClFNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Propan-2-yl 2-chloro-5-(1,3-dioxo-1,3,4,5,6,7-hexahydro-2h-isoindol-2-yl)-4-fluorobenzoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H17ClFNO4 |
|---|---|
| Molecular Weight | 365.8 |
| InChIKey | LKXJESTUTBOTSI-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)C1=CC(=C(C=C1Cl)F)N2C(=O)C3=C(C2=O)CCCC3 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
Total 7, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Propan-2-yl 2-chloro-5-(1,3-dioxo-1,3,4,5,6,7-hexahydro-2h-isoindol-2-yl)-4-fluorobenzoate? |
| A: SMILES notation of Propan-2-yl 2-chloro-5-(1,3-dioxo-1,3,4,5,6,7-hexahydro-2h-isoindol-2-yl)-4-fluorobenzoate is CC(C)OC(=O)C1=CC(=C(C=C1Cl)F)N2C(=O)C3=C(C2=O)CCCC3. |
| Q: What is the English name of Propan-2-yl 2-chloro-5-(1,3-dioxo-1,3,4,5,6,7-hexahydro-2h-isoindol-2-yl)-4-fluorobenzoate? |
| A: The English name of Propan-2-yl 2-chloro-5-(1,3-dioxo-1,3,4,5,6,7-hexahydro-2h-isoindol-2-yl)-4-fluorobenzoate is Propan-2-yl 2-chloro-5-(1,3-dioxo-1,3,4,5,6,7-hexahydro-2h-isoindol-2-yl)-4-fluorobenzoate. |
| Q: What is the molecular formula of Propan-2-yl 2-chloro-5-(1,3-dioxo-1,3,4,5,6,7-hexahydro-2h-isoindol-2-yl)-4-fluorobenzoate? |
| A: Molecular formula of Propan-2-yl 2-chloro-5-(1,3-dioxo-1,3,4,5,6,7-hexahydro-2h-isoindol-2-yl)-4-fluorobenzoate is C18H17ClFNO4. |
| Q: What is the Chinese name of 81663-36-7? |
| A: Chinese name of 81663-36-7 is 81663-36-7. |
| Q: What is the InChIKey of Propan-2-yl 2-chloro-5-(1,3-dioxo-1,3,4,5,6,7-hexahydro-2h-isoindol-2-yl)-4-fluorobenzoate? |
| A: InChIKey of Propan-2-yl 2-chloro-5-(1,3-dioxo-1,3,4,5,6,7-hexahydro-2h-isoindol-2-yl)-4-fluorobenzoate is LKXJESTUTBOTSI-UHFFFAOYSA-N. |
| Q: What is the CAS number of Propan-2-yl 2-chloro-5-(1,3-dioxo-1,3,4,5,6,7-hexahydro-2h-isoindol-2-yl)-4-fluorobenzoate? |
| A: CAS number of Propan-2-yl 2-chloro-5-(1,3-dioxo-1,3,4,5,6,7-hexahydro-2h-isoindol-2-yl)-4-fluorobenzoate is 81663-36-7. |
| Q: What is the molecular weight of Propan-2-yl 2-chloro-5-(1,3-dioxo-1,3,4,5,6,7-hexahydro-2h-isoindol-2-yl)-4-fluorobenzoate? |
| A: Molecular weight of Propan-2-yl 2-chloro-5-(1,3-dioxo-1,3,4,5,6,7-hexahydro-2h-isoindol-2-yl)-4-fluorobenzoate is 365.8. |