Spiro(1-azabicyclo(2.2.2)octane-3,4-imidazolidine)-2,5-dione, 1-((phenyl(phenylmethyl)amino)methyl)- structure
|
Common Name | Spiro(1-azabicyclo(2.2.2)octane-3,4-imidazolidine)-2,5-dione, 1-((phenyl(phenylmethyl)amino)methyl)- | ||
|---|---|---|---|---|
| CAS Number | 81547-29-7 | Molecular Weight | 390.47800 | |
| Density | 1.32g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C23H26N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3'-[(N-benzylanilino)methyl]spiro[1-azabicyclo[2.2.2]octane-3,5'-imidazolidine]-2',4'-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.32g/cm3 |
|---|---|
| Molecular Formula | C23H26N4O2 |
| Molecular Weight | 390.47800 |
| Exact Mass | 390.20600 |
| PSA | 55.89000 |
| LogP | 2.87150 |
| Index of Refraction | 1.682 |
| InChIKey | CHPHBKYGPSWUQY-UHFFFAOYSA-N |
| SMILES | O=C1NC2(CN3CCC2CC3)C(=O)N1CN(Cc1ccccc1)c1ccccc1 |
|
~63%
Spiro(1-azabicy... CAS#:81547-29-7 |
| Literature: Trigo, G. G.; Martinez, M.; Galvez, E.; Cabezas, R. Journal of Heterocyclic Chemistry, 1981 , vol. 18, p. 1507 - 1511 |
|
~%
Spiro(1-azabicy... CAS#:81547-29-7 |
| Literature: Trigo, G. G.; Martinez, M.; Galvez, E.; Cabezas, R. Journal of Heterocyclic Chemistry, 1981 , vol. 18, p. 1507 - 1511 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Spiro(1-azabicyclo(2.2.2)octane-3,4'-imidazolidine)-2',5'-dione,1'-((phenyl(phenylmethyl)amino)methyl) |
| 3'-(N-benzyl-N-phenylaminomethyl)quinuclidine-3-spiro-5'-hydantoin |