3-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]benzooxazol-2- one
Modify Date: 2025-09-24 16:44:34
![3-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]benzooxazol-2- one Structure](https://image.chemsrc.com/caspic/067/81513-96-4.png)
3-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]benzooxazol-2- one structure
|
Common Name | 3-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]benzooxazol-2- one | ||
|---|---|---|---|---|
| CAS Number | 81513-96-4 | Molecular Weight | 391.38700 | |
| Density | 1.317g/cm3 | Boiling Point | 503.6ºC at 760 mmHg | |
| Molecular Formula | C20H20F3N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 258.4ºC | |
| Name | 3-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]-1,3-benzoxazol-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.317g/cm3 |
|---|---|
| Boiling Point | 503.6ºC at 760 mmHg |
| Molecular Formula | C20H20F3N3O2 |
| Molecular Weight | 391.38700 |
| Flash Point | 258.4ºC |
| Exact Mass | 391.15100 |
| PSA | 41.62000 |
| LogP | 3.43840 |
| Index of Refraction | 1.565 |
| InChIKey | XSYHGQBDXPLCNF-UHFFFAOYSA-N |
| SMILES | O=c1oc2ccccc2n1CCN1CCN(c2cccc(C(F)(F)F)c2)CC1 |
|
~%
3-[2-[4-[3-(tri... CAS#:81513-96-4 |
| Literature: Bermann; Bonte; Lesieur-Demarquilly; et al. European Journal of Medicinal Chemistry, 1982 , vol. 17, # 1 p. 85 - 88 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3-(2-(4-(3-(Trifluoromethyl)phenyl)-1-piperazinyl)ethyl)-2(3H)-benzoxazolone |
| 2(3H)-Benzoxazolone,3-(2-(4-(3-(trifluoromethyl)phenyl)-1-piperazinyl)ethyl) |