(3'-METHOXY-[1,1'-BIPHENYL]-4-YL)METHANOL structure
|
Common Name | (3'-METHOXY-[1,1'-BIPHENYL]-4-YL)METHANOL | ||
|---|---|---|---|---|
| CAS Number | 81443-45-0 | Molecular Weight | 214.26000 | |
| Density | 1.113g/cm3 | Boiling Point | 369.254ºC at 760 mmHg | |
| Molecular Formula | C14H14O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 168.75ºC | |
| Name | [4-(3-methoxyphenyl)phenyl]methanol |
|---|
| Density | 1.113g/cm3 |
|---|---|
| Boiling Point | 369.254ºC at 760 mmHg |
| Molecular Formula | C14H14O2 |
| Molecular Weight | 214.26000 |
| Flash Point | 168.75ºC |
| Exact Mass | 214.09900 |
| PSA | 29.46000 |
| LogP | 2.85450 |
| Index of Refraction | 1.579 |
| InChIKey | IJIHRRZFDGSFOQ-UHFFFAOYSA-N |
| SMILES | COc1cccc(-c2ccc(CO)cc2)c1 |
| HS Code | 2922299090 |
|---|
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |