19(R)-hydroxy Prostaglandin F1α (19(R)-hydroxy PGF1α)
Modify Date: 2025-10-15 08:22:47
19(R)-hydroxy Prostaglandin F1α (19(R)-hydroxy PGF1α) structure
|
Common Name | 19(R)-hydroxy Prostaglandin F1α (19(R)-hydroxy PGF1α) | ||
|---|---|---|---|---|
| CAS Number | 81371-59-7 | Molecular Weight | 372.496 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 594.2±50.0 °C at 760 mmHg | |
| Molecular Formula | C20H36O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 327.2±26.6 °C | |
Use of 19(R)-hydroxy Prostaglandin F1α (19(R)-hydroxy PGF1α)19(R)-hydroxy PGF1α is an ω-1 hydroxylase metabolite of PGF1α that has been identified in the semen of humans and marsupials |
| Name | 19(r)-hydroxy prostaglandin f1alpha |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 594.2±50.0 °C at 760 mmHg |
| Molecular Formula | C20H36O6 |
| Molecular Weight | 372.496 |
| Flash Point | 327.2±26.6 °C |
| Exact Mass | 372.251190 |
| PSA | 118.22000 |
| LogP | 0.41 |
| Vapour Pressure | 0.0±3.8 mmHg at 25°C |
| Index of Refraction | 1.570 |
| InChIKey | JRNZEGAFLBTZDT-IRMCVWCUSA-N |
| SMILES | CC(O)CCCC(O)C=CC1C(O)CC(O)C1CCCCCCC(=O)O |
| 9alpha,11alpha,15s,19r-tetrahydroxy-prost-13e-en-1-oic acid |
| (9α,11α,13E,15S,19R)-9,11,15,19-Tetrahydroxyprost-13-en-1-oic acid |
| Prost-13-en-1-oic acid, 9,11,15,19-tetrahydroxy-, (9α,11α,13E,15S,19R)- |