Heptanedioic acid,2-hydroxy-4,4-dinitro-, 1,7-dimethyl ester
Modify Date: 2025-08-25 15:32:54
Heptanedioic acid,2-hydroxy-4,4-dinitro-, 1,7-dimethyl ester structure
|
Common Name | Heptanedioic acid,2-hydroxy-4,4-dinitro-, 1,7-dimethyl ester | ||
|---|---|---|---|---|
| CAS Number | 813-90-1 | Molecular Weight | 294.21500 | |
| Density | 1.417g/cm3 | Boiling Point | 458.1ºC at 760 mmHg | |
| Molecular Formula | C9H14N2O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 230.9ºC | |
| Name | dimethyl 2-hydroxy-4,4-dinitroheptanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.417g/cm3 |
|---|---|
| Boiling Point | 458.1ºC at 760 mmHg |
| Molecular Formula | C9H14N2O9 |
| Molecular Weight | 294.21500 |
| Flash Point | 230.9ºC |
| Exact Mass | 294.07000 |
| PSA | 164.47000 |
| LogP | 0.15970 |
| Index of Refraction | 1.497 |
| InChIKey | UJIAPSGLWBJOJA-UHFFFAOYSA-N |
| SMILES | COC(=O)CCC(CC(O)C(=O)OC)([N+](=O)[O-])[N+](=O)[O-] |
|
~%
Heptanedioic ac... CAS#:813-90-1 |
| Literature: Kaplan,L.A.; Kamlet,M.J. Journal of Organic Chemistry, 1962 , vol. 27, p. 780 - 785 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4,4-Dinitro-2-hydroxy-heptan-disaeure-(1,7)-dimethylester |
| dimethyl 4,4-dinitro-2-hydroxypimelate |
| 4,4-Dinitro-2-hydroxy-pimelinsaeure-dimethylester |
| 4,4-Dinitro-2-hydroxy-heptandisaeuredimethylester |