2-(2-ethoxy-4-formyl-6-nitrophenoxy)propanoic acid
Modify Date: 2025-10-01 18:01:07
2-(2-ethoxy-4-formyl-6-nitrophenoxy)propanoic acid structure
|
Common Name | 2-(2-ethoxy-4-formyl-6-nitrophenoxy)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 812642-72-1 | Molecular Weight | 283.23400 | |
| Density | 1.378g/cm3 | Boiling Point | 490.2ºC at 760 mmHg | |
| Molecular Formula | C12H13NO7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 250.2ºC | |
| Name | 2-(2-ethoxy-4-formyl-6-nitrophenoxy)propanoic acid |
|---|
| Density | 1.378g/cm3 |
|---|---|
| Boiling Point | 490.2ºC at 760 mmHg |
| Molecular Formula | C12H13NO7 |
| Molecular Weight | 283.23400 |
| Flash Point | 250.2ºC |
| Exact Mass | 283.06900 |
| PSA | 118.65000 |
| LogP | 2.18110 |
| Index of Refraction | 1.579 |
| InChIKey | ZCZIHDVSTSPBPF-UHFFFAOYSA-N |
| SMILES | CCOc1cc(C=O)cc([N+](=O)[O-])c1OC(C)C(=O)O |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |