3-methylbut-2-enyl-[2-(3-methylbut-2-enyl-diphenyl-phosphaniumyl)ethyl]-diphenyl-phosphanium structure
|
Common Name | 3-methylbut-2-enyl-[2-(3-methylbut-2-enyl-diphenyl-phosphaniumyl)ethyl]-diphenyl-phosphanium | ||
|---|---|---|---|---|
| CAS Number | 81194-90-3 | Molecular Weight | 572.11900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C36H42ClP2+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-methylbut-2-enyl-[2-[3-methylbut-2-enyl(diphenyl)phosphaniumyl]ethyl]-diphenylphosphanium,chloride |
|---|
| Molecular Formula | C36H42ClP2+ |
|---|---|
| Molecular Weight | 572.11900 |
| Exact Mass | 571.24500 |
| PSA | 27.18000 |
| LogP | 5.26000 |
| InChIKey | PVIGQCODDIUNGQ-UHFFFAOYSA-M |
| SMILES | CC(C)=CC[P+](CC[P+](CC=C(C)C)(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1.[Cl-] |
|
~%
3-methylbut-2-e... CAS#:81194-90-3 |
| Literature: Gurusamy, Narayanasamy; Berlin, K.Darrel; Helm, Dick van der; Hossain, M.Bilayet Journal of the American Chemical Society, 1982 , vol. 104, # 11 p. 3107 - 3114 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |