AKOS B018325 structure
|
Common Name | AKOS B018325 | ||
|---|---|---|---|---|
| CAS Number | 81154-02-1 | Molecular Weight | 251.32500 | |
| Density | 1.42g/cm3 | Boiling Point | 403.1ºC at 760 mmHg | |
| Molecular Formula | C11H9NO2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.6ºC | |
| Name | (5E)-5-[(3-methoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.42g/cm3 |
|---|---|
| Boiling Point | 403.1ºC at 760 mmHg |
| Molecular Formula | C11H9NO2S2 |
| Molecular Weight | 251.32500 |
| Flash Point | 197.6ºC |
| Exact Mass | 251.00700 |
| PSA | 102.76000 |
| LogP | 2.03090 |
| Index of Refraction | 1.699 |
| InChIKey | ZXBRDIMYFRPBGK-RMKNXTFCSA-N |
| SMILES | COc1cccc(C=C2SC(=S)NC2=O)c1 |
| HS Code | 2934100090 |
|---|
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| (5E)-2-mercapto-5-(3-methoxybenzylidene)-1,3-thiazol-4(5H)-one |