AKOS B018295
Modify Date: 2024-01-15 18:37:25
AKOS B018295 structure
|
Common Name | AKOS B018295 | ||
|---|---|---|---|---|
| CAS Number | 81154-00-9 | Molecular Weight | 255.74400 | |
| Density | 1.54g/cm3 | Boiling Point | 395.8ºC at 760 mmHg | |
| Molecular Formula | C10H6ClNOS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.2ºC | |
| Name | (5E)-5-[(2-chlorophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|
| Density | 1.54g/cm3 |
|---|---|
| Boiling Point | 395.8ºC at 760 mmHg |
| Molecular Formula | C10H6ClNOS2 |
| Molecular Weight | 255.74400 |
| Flash Point | 193.2ºC |
| Exact Mass | 254.95800 |
| PSA | 93.53000 |
| LogP | 2.67570 |
| Index of Refraction | 1.738 |
| InChIKey | AAIBSXUAGRXSIQ-VMPITWQZSA-N |
| SMILES | O=C1NC(=S)SC1=Cc1ccccc1Cl |
| HS Code | 2934100090 |
|---|
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |