3-ethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one structure
|
Common Name | 3-ethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one | ||
|---|---|---|---|---|
| CAS Number | 81136-41-6 | Molecular Weight | 234.31700 | |
| Density | 1.4g/cm3 | Boiling Point | 434.6ºC at 760 mmHg | |
| Molecular Formula | C12H14N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.6ºC | |
| Name | 3-ethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4g/cm3 |
|---|---|
| Boiling Point | 434.6ºC at 760 mmHg |
| Molecular Formula | C12H14N2OS |
| Molecular Weight | 234.31700 |
| Flash Point | 216.6ºC |
| Exact Mass | 234.08300 |
| PSA | 63.13000 |
| LogP | 2.35670 |
| Index of Refraction | 1.717 |
| InChIKey | KRHVSDUNLZMMEB-UHFFFAOYSA-N |
| SMILES | CCn1cnc2sc3c(c2c1=O)CCCC3 |
|
~26%
3-ethyl-5,6,7,8... CAS#:81136-41-6 |
| Literature: Bohm; Pech; Schneider Pharmazie, 1983 , vol. 38, # 2 p. 135 - 136 |
|
~28%
3-ethyl-5,6,7,8... CAS#:81136-41-6 |
| Literature: Ram; Pandey; Vlietinck Journal of Heterocyclic Chemistry, 1981 , vol. 18, # 7 p. 1277 - 1280 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HMS1691B18 |
| 3-N-ethyl-4-oxo-5,6-tetramethylenothieno<2,3-d>pyrimidine |