9-(2-hydroxy-3-nonyl)purine
Modify Date: 2025-08-20 13:39:40
9-(2-hydroxy-3-nonyl)purine structure
|
Common Name | 9-(2-hydroxy-3-nonyl)purine | ||
|---|---|---|---|---|
| CAS Number | 81129-36-4 | Molecular Weight | 262.35100 | |
| Density | 1.18g/cm3 | Boiling Point | 418.1ºC at 760 mmHg | |
| Molecular Formula | C14H22N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.7ºC | |
| Name | 3-purin-9-ylnonan-2-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 418.1ºC at 760 mmHg |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.35100 |
| Flash Point | 206.7ºC |
| Exact Mass | 262.17900 |
| PSA | 63.83000 |
| LogP | 2.71860 |
| Index of Refraction | 1.598 |
| InChIKey | ZTSORWGHRMIOHU-YPMHNXCESA-N |
| SMILES | CCCCCCC(C(C)O)n1cnc2cncnc21 |
|
~%
9-(2-hydroxy-3-... CAS#:81129-36-4 |
| Literature: Woo; Baker Journal of medicinal chemistry, 1982 , vol. 25, # 5 p. 603 - 605 |
| erythro-9-(2-hydroxy-3-nonyl)purine |
| 9-(2-Hydroxy-3-nonyl)purine |