Urea, N- (2-chloroethyl)-N-[2-(5-fluoro-3,4-dihydro- 2, 4-dioxo-1(2H)-pyrimidinyl)-2-(methylthio)ethyl]- N-nitroso- structure
|
Common Name | Urea, N- (2-chloroethyl)-N-[2-(5-fluoro-3,4-dihydro- 2, 4-dioxo-1(2H)-pyrimidinyl)-2-(methylthio)ethyl]- N-nitroso- | ||
|---|---|---|---|---|
| CAS Number | 81068-96-4 | Molecular Weight | 353.75800 | |
| Density | 1.63g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H13ClFN5O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(2-chloroethyl)-3-[2-(5-fluoro-2,4-dioxopyrimidin-1-yl)-2-methylsulfanylethyl]-1-nitrosourea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.63g/cm3 |
|---|---|
| Molecular Formula | C10H13ClFN5O4S |
| Molecular Weight | 353.75800 |
| Exact Mass | 353.03600 |
| PSA | 141.93000 |
| LogP | 0.86000 |
| Index of Refraction | 1.649 |
| InChIKey | PDHDKLAKLKCEPQ-UHFFFAOYSA-N |
| SMILES | CSC(CNC(=O)N(CCCl)N=O)n1cc(F)c(=O)[nH]c1=O |
|
~44%
Urea, N- (2-chl... CAS#:81068-96-4 |
| Literature: McCormick, Joan E.; McElbinney, R. Stanley Journal of Chemical Research, Miniprint, 1981 , # 10 p. 3601 - 3641 |
|
~%
Urea, N- (2-chl... CAS#:81068-96-4 |
| Literature: McCormick, Joan E.; McElbinney, R. Stanley Journal of Chemical Research, Miniprint, 1981 , # 10 p. 3601 - 3641 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| urea,n-(2-chloroethyl)-n'-[2-(5-fluoro-3,4-dihydro-2,4-dioxo-1(2h)-pyrimidinyl)-2-(methylthio)ethyl]-n-nitroso |
| B 3839 |