Benzenesulfonylfluoride, 4-[[[3-(hydroxymethyl)phenyl]amino]carbonyl]- structure
|
Common Name | Benzenesulfonylfluoride, 4-[[[3-(hydroxymethyl)phenyl]amino]carbonyl]- | ||
|---|---|---|---|---|
| CAS Number | 80936-68-1 | Molecular Weight | 309.31300 | |
| Density | 1.453g/cm3 | Boiling Point | 404.9ºC at 760 mmHg | |
| Molecular Formula | C14H12FNO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.7ºC | |
| Name | 4-[[3-(hydroxymethyl)phenyl]carbamoyl]benzenesulfonyl fluoride |
|---|
| Density | 1.453g/cm3 |
|---|---|
| Boiling Point | 404.9ºC at 760 mmHg |
| Molecular Formula | C14H12FNO4S |
| Molecular Weight | 309.31300 |
| Flash Point | 198.7ºC |
| Exact Mass | 309.04700 |
| PSA | 91.85000 |
| LogP | 3.24320 |
| Index of Refraction | 1.621 |
| InChIKey | INHXUFSRHDZVNT-UHFFFAOYSA-N |
| SMILES | O=C(Nc1cccc(CO)c1)c1ccc(S(=O)(=O)F)cc1 |
|
~81%
Benzenesulfonyl... CAS#:80936-68-1 |
| Literature: Kelley, James L.; Baker, B. R. Journal of Medicinal Chemistry, 1982 , vol. 25, # 5 p. 600 - 603 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |